CAS 1248011-19-9 appears in our catalog under these names: 2,2-Difluoro-2-(1-methyl-1H-pyrazol-4-yl)acetic acid, 98%, 2,2-Difluoro-2-(1-methyl-1H-pyrazol-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
2,2-difluoro-2-(1-methylpyrazol-4-yl)acetic acid (CAS 1248011-19-9) is a chemical compound with the molecular formula C6H6F2N2O2 and a molecular weight of 176.12 g/mol. IUPAC name: 2,2-difluoro-2-(1-methylpyrazol-4-yl)acetic acid. InChIKey: STZXHNOPMDVSKA-UHFFFAOYSA-N.
| Molecular formula | C6H6F2N2O2 |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | 2,2-difluoro-2-(1-methylpyrazol-4-yl)acetic acid |
| InChIKey | STZXHNOPMDVSKA-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)