CAS 1248517-44-3 is the registry number for 3-(Cyclobutylamino)benzonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-(cyclobutylamino)benzonitrile (CAS 1248517-44-3) is a chemical compound with the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. IUPAC name: 3-(cyclobutylamino)benzonitrile. InChIKey: PJYURDCNCGPZIN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | 3-(cyclobutylamino)benzonitrile |
| InChIKey | PJYURDCNCGPZIN-UHFFFAOYSA-N |
| SMILES | C1CC(C1)NC2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)