Products 1248787-60-1
CAS 1248787-60-1 is the registry number for (2,5-Dichlorophenyl)(oxolan-3-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2,5-dichlorophenyl)-(oxolan-3-yl)methanamine (CAS 1248787-60-1) is a chemical compound with the molecular formula C11H13Cl2NO and a molecular weight of 246.13 g/mol. IUPAC name: (2,5-dichlorophenyl)-(oxolan-3-yl)methanamine. InChIKey: IEPFJYJWIRRJLA-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-(oxolan-3-yl)methanamine |
| InChIKey | IEPFJYJWIRRJLA-UHFFFAOYSA-N |
| SMILES | C1COCC1C(C2=C(C=CC(=C2)Cl)Cl)N |
Computed by PubChem (NCBI)