Products 1248965-63-0
CAS 1248965-63-0 is the registry number for 4-(2-Chlorophenyl)-1,3-oxazol-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(2-chlorophenyl)-1,3-oxazol-2-amine (CAS 1248965-63-0) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 4-(2-chlorophenyl)-1,3-oxazol-2-amine. InChIKey: LCVLNQQCYQAJTH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 4-(2-chlorophenyl)-1,3-oxazol-2-amine |
| InChIKey | LCVLNQQCYQAJTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=COC(=N2)N)Cl |
Computed by PubChem (NCBI)