CAS 1248969-69-8 is the registry number for 5,8-Dibromo-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 50mg, 250mg, 100mg, 500mg, 1000mg.
5,8-dibromo-1,2,3,4-tetrahydroquinoline (CAS 1248969-69-8) is a chemical compound with the molecular formula C9H9Br2N and a molecular weight of 290.98 g/mol. IUPAC name: 5,8-dibromo-1,2,3,4-tetrahydroquinoline. InChIKey: MONABZJAHIPXQV-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2N |
|---|---|
| Molecular weight | 290.98 g/mol |
| IUPAC name | 5,8-dibromo-1,2,3,4-tetrahydroquinoline |
| InChIKey | MONABZJAHIPXQV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2NC1)Br)Br |
Computed by PubChem (NCBI)