CAS 190843-73-3 appears in our catalog under these names: 6,8-Dibromo-1,2,3,4-tetrahydroquinoline, 95%, 6,8-Dibromo-1,2,3,4-tetrahydroquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6,8-dibromo-1,2,3,4-tetrahydroquinoline (CAS 190843-73-3) is a chemical compound with the molecular formula C9H9Br2N and a molecular weight of 290.98 g/mol. IUPAC name: 6,8-dibromo-1,2,3,4-tetrahydroquinoline. InChIKey: SNSRBNSPFBIZRO-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2N |
|---|---|
| Molecular weight | 290.98 g/mol |
| IUPAC name | 6,8-dibromo-1,2,3,4-tetrahydroquinoline |
| InChIKey | SNSRBNSPFBIZRO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)Br)Br)NC1 |
Computed by PubChem (NCBI)