CAS 1824093-18-6 is the registry number for 6,7-Dibromo-2,3-dihydro-1H-inden-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dibromo-2,3-dihydro-1H-inden-1-amine (CAS 1824093-18-6) is a chemical compound with the molecular formula C9H9Br2N and a molecular weight of 290.98 g/mol. IUPAC name: 6,7-dibromo-2,3-dihydro-1H-inden-1-amine. InChIKey: UEKBPQZKBBAXGR-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2N |
|---|---|
| Molecular weight | 290.98 g/mol |
| IUPAC name | 6,7-dibromo-2,3-dihydro-1H-inden-1-amine |
| InChIKey | UEKBPQZKBBAXGR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C(=C(C=C2)Br)Br |
Computed by PubChem (NCBI)