CAS 1989671-73-9 is the registry number for 6,7-Dibromo-1,2,3,4-tetrahydroisoquinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,7-dibromo-1,2,3,4-tetrahydroisoquinoline (CAS 1989671-73-9) is a chemical compound with the molecular formula C9H9Br2N and a molecular weight of 290.98 g/mol. IUPAC name: 6,7-dibromo-1,2,3,4-tetrahydroisoquinoline. InChIKey: XQDWQUYJNXAGSD-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2N |
|---|---|
| Molecular weight | 290.98 g/mol |
| IUPAC name | 6,7-dibromo-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | XQDWQUYJNXAGSD-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(C=C21)Br)Br |
Computed by PubChem (NCBI)