Products 863870-39-7
CAS 863870-39-7 is the registry number for 2-(2-2-Dibromovinyl)-3-methylphenylamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
2-(2,2-dibromoethenyl)-3-methylaniline (CAS 863870-39-7) is a chemical compound with the molecular formula C9H9Br2N and a molecular weight of 290.98 g/mol. IUPAC name: 2-(2,2-dibromoethenyl)-3-methylaniline. InChIKey: DYZVEHTXOGQYOT-UHFFFAOYSA-N.
| Molecular formula | C9H9Br2N |
|---|---|
| Molecular weight | 290.98 g/mol |
| IUPAC name | 2-(2,2-dibromoethenyl)-3-methylaniline |
| InChIKey | DYZVEHTXOGQYOT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N)C=C(Br)Br |
Computed by PubChem (NCBI)