CAS 1248992-53-1 appears in our catalog under these names: 3-((Dimethyl-1H-1,2,4-triazol-1-yl)methyl)aniline, 95%, 3-((Dimethyl-1H-1,2,4-triazol-1-yl)methyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]aniline (CAS 1248992-53-1) is a chemical compound with the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. IUPAC name: 3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]aniline. InChIKey: PDBSHCMJJQCTIS-UHFFFAOYSA-N.
| Molecular formula | C11H14N4 |
|---|---|
| Molecular weight | 202.26 g/mol |
| IUPAC name | 3-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]aniline |
| InChIKey | PDBSHCMJJQCTIS-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)C)CC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)