CAS 1249156-21-5 appears in our catalog under these names: 1-(2,6-Dichlorophenyl)cyclopropan-1-ol, 95%, 1-(2,6-Dichlorophenyl)cyclopropan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(2,6-dichlorophenyl)cyclopropan-1-ol (CAS 1249156-21-5) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)cyclopropan-1-ol. InChIKey: IWYYBUFJDSTZOZ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)cyclopropan-1-ol |
| InChIKey | IWYYBUFJDSTZOZ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=CC=C2Cl)Cl)O |
Computed by PubChem (NCBI)