Products 1249190-68-8

CAS 1249190-68-8 is the registry number for 2-(2,5-Dichlorophenyl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-(2,5-dichlorophenyl)propanoic acid (CAS 1249190-68-8) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)propanoic acid. InChIKey: XAFWOKHOVFWWBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O2
Molecular weight219.06 g/mol
IUPAC name2-(2,5-dichlorophenyl)propanoic acid
InChIKeyXAFWOKHOVFWWBQ-UHFFFAOYSA-N
SMILESCC(C1=C(C=CC(=C1)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)