CAS 1249349-53-8 is the registry number for 2-(1-Methyl-1H-pyrazol-4-yl)pyrimidin-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-methylpyrazol-4-yl)pyrimidin-4-amine (CAS 1249349-53-8) is a chemical compound with the molecular formula C8H9N5 and a molecular weight of 175.19 g/mol. IUPAC name: 2-(1-methylpyrazol-4-yl)pyrimidin-4-amine. InChIKey: JKOPUKSGHPCYDF-UHFFFAOYSA-N.
| Molecular formula | C8H9N5 |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 2-(1-methylpyrazol-4-yl)pyrimidin-4-amine |
| InChIKey | JKOPUKSGHPCYDF-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=NC=CC(=N2)N |
Computed by PubChem (NCBI)