Products 1249585-01-0

CAS 1249585-01-0 is the registry number for 2-(3-Iodophenyl)-5-methyloxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3-iodophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid (CAS 1249585-01-0) is a chemical compound with the molecular formula C11H8INO3 and a molecular weight of 329.09 g/mol. IUPAC name: 2-(3-iodophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid. InChIKey: ZZQCXOQKPBCJIP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8INO3
Molecular weight329.09 g/mol
IUPAC name2-(3-iodophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid
InChIKeyZZQCXOQKPBCJIP-UHFFFAOYSA-N
SMILESCC1=C(N=C(O1)C2=CC(=CC=C2)I)C(=O)O

Computed by PubChem (NCBI)