Products 2721374-10-1
CAS 2721374-10-1 is the registry number for 3-Iodo-8-methoxyquinoline-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-iodo-8-methoxyquinoline-6-carboxylic acid (CAS 2721374-10-1) is a chemical compound with the molecular formula C11H8INO3 and a molecular weight of 329.09 g/mol. IUPAC name: 3-iodo-8-methoxyquinoline-6-carboxylic acid. InChIKey: DYJUFFLDCAWNOD-UHFFFAOYSA-N.
| Molecular formula | C11H8INO3 |
|---|---|
| Molecular weight | 329.09 g/mol |
| IUPAC name | 3-iodo-8-methoxyquinoline-6-carboxylic acid |
| InChIKey | DYJUFFLDCAWNOD-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC(=C1)C(=O)O)C=C(C=N2)I |
Computed by PubChem (NCBI)