CAS 1429765-70-7 appears in our catalog under these names: 2-Iodo-1-methoxy-4-nitronaphthalene, 95%, 2-Iodo-1-methoxy-4-nitronaphthalene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 100mg, 500mg, 1000mg, 2000mg.
2-iodo-1-methoxy-4-nitronaphthalene (CAS 1429765-70-7) is a chemical compound with the molecular formula C11H8INO3 and a molecular weight of 329.09 g/mol. IUPAC name: 2-iodo-1-methoxy-4-nitronaphthalene. InChIKey: LCSOITAPPJSAGU-UHFFFAOYSA-N.
| Molecular formula | C11H8INO3 |
|---|---|
| Molecular weight | 329.09 g/mol |
| IUPAC name | 2-iodo-1-methoxy-4-nitronaphthalene |
| InChIKey | LCSOITAPPJSAGU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C2=CC=CC=C21)[N+](=O)[O-])I |
Computed by PubChem (NCBI)