Products 1370420-73-7

CAS 1370420-73-7 is the registry number for 3-(2-Iodophenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2-iodophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1370420-73-7) is a chemical compound with the molecular formula C11H8INO3 and a molecular weight of 329.09 g/mol. IUPAC name: 3-(2-iodophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: XUQQYHZAFUOHMS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8INO3
Molecular weight329.09 g/mol
IUPAC name3-(2-iodophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyXUQQYHZAFUOHMS-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=CC=CC=C2I)C(=O)O

Computed by PubChem (NCBI)