CAS 609848-44-4 is the registry number for Methyl 5-(3-iodophenyl)isoxazole-3-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Methyl 5-(3-iodophenyl)-1,2-oxazole-3-carboxylate (CAS 609848-44-4) is a chemical compound with the molecular formula C11H8INO3 and a molecular weight of 329.09 g/mol. IUPAC name: methyl 5-(3-iodophenyl)-1,2-oxazole-3-carboxylate. InChIKey: UHXBOKFBICKPMC-UHFFFAOYSA-N.
| Molecular formula | C11H8INO3 |
|---|---|
| Molecular weight | 329.09 g/mol |
| IUPAC name | methyl 5-(3-iodophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | UHXBOKFBICKPMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC(=C1)C2=CC(=CC=C2)I |
Computed by PubChem (NCBI)