Products 1249836-50-7

CAS 1249836-50-7 is the registry number for 5-((Ethylsulfinyl)methyl)furan-2-carboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(ethylsulfinylmethyl)furan-2-carboxylic acid (CAS 1249836-50-7) is a chemical compound with the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. IUPAC name: 5-(ethylsulfinylmethyl)furan-2-carboxylic acid. InChIKey: MWPGJKDMTUWOGG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O4S
Molecular weight202.23 g/mol
IUPAC name5-(ethylsulfinylmethyl)furan-2-carboxylic acid
InChIKeyMWPGJKDMTUWOGG-UHFFFAOYSA-N
SMILESCCS(=O)CC1=CC=C(O1)C(=O)O

Computed by PubChem (NCBI)