Products 1894891-77-0

CAS 1894891-77-0 is the registry number for 3-(1,1-Dioxidotetrahydro-2H-thiopyran-3-yl)propiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(1,1-dioxothian-3-yl)prop-2-ynoic acid (CAS 1894891-77-0) is a chemical compound with the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. IUPAC name: 3-(1,1-dioxothian-3-yl)prop-2-ynoic acid. InChIKey: BTLVMFKJTZQTFI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O4S
Molecular weight202.23 g/mol
IUPAC name3-(1,1-dioxothian-3-yl)prop-2-ynoic acid
InChIKeyBTLVMFKJTZQTFI-UHFFFAOYSA-N
SMILESC1CC(CS(=O)(=O)C1)C#CC(=O)O

Computed by PubChem (NCBI)