CAS 2137793-42-9 is the registry number for 1-Oxa-8λâ¶-thiaspiro(4.5)dec-2-ene-4,8,8-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8,8-dioxo-1-oxa-8lambda6-thiaspiro[4.5]dec-2-en-4-one (CAS 2137793-42-9) is a chemical compound with the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. IUPAC name: 8,8-dioxo-1-oxa-8lambda6-thiaspiro[4.5]dec-2-en-4-one. InChIKey: PWEPQPHKMCSXLW-UHFFFAOYSA-N.
| Molecular formula | C8H10O4S |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 8,8-dioxo-1-oxa-8lambda6-thiaspiro[4.5]dec-2-en-4-one |
| InChIKey | PWEPQPHKMCSXLW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC12C(=O)C=CO2 |
Computed by PubChem (NCBI)