CAS 1896485-66-7 is the registry number for 3-(1,1-Dioxidotetrahydro-2H-thiopyran-4-yl)propiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-dioxothian-4-yl)prop-2-ynoic acid (CAS 1896485-66-7) is a chemical compound with the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. IUPAC name: 3-(1,1-dioxothian-4-yl)prop-2-ynoic acid. InChIKey: MRIFXJXCXQAOCW-UHFFFAOYSA-N.
| Molecular formula | C8H10O4S |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 3-(1,1-dioxothian-4-yl)prop-2-ynoic acid |
| InChIKey | MRIFXJXCXQAOCW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1C#CC(=O)O |
Computed by PubChem (NCBI)