CAS 1250126-45-4 is the registry number for Letrozole Impurity 57. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,2,4-triazol-4-ylmethyl)benzoic acid (CAS 1250126-45-4) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 4-(1,2,4-triazol-4-ylmethyl)benzoic acid. InChIKey: ZMJWENLBAQMZOS-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 4-(1,2,4-triazol-4-ylmethyl)benzoic acid |
| InChIKey | ZMJWENLBAQMZOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NN=C2)C(=O)O |
Computed by PubChem (NCBI)