Products 1250139-60-6
CAS 1250139-60-6 is the registry number for 4-Bromo-N-methoxy-N-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-N-methoxy-N-methylbenzenesulfonamide (CAS 1250139-60-6) is a chemical compound with the molecular formula C8H10BrNO3S and a molecular weight of 280.14 g/mol. IUPAC name: 4-bromo-N-methoxy-N-methylbenzenesulfonamide. InChIKey: LBEJPWZHDYWEFI-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO3S |
|---|---|
| Molecular weight | 280.14 g/mol |
| IUPAC name | 4-bromo-N-methoxy-N-methylbenzenesulfonamide |
| InChIKey | LBEJPWZHDYWEFI-UHFFFAOYSA-N |
| SMILES | CN(OC)S(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)