Products 1250536-34-5

CAS 1250536-34-5 is the registry number for 3-(2,3-Dimethylphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2,3-dimethylphenyl)-2-oxopropanoic acid (CAS 1250536-34-5) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-(2,3-dimethylphenyl)-2-oxopropanoic acid. InChIKey: SCOPIBMUIURTPA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC name3-(2,3-dimethylphenyl)-2-oxopropanoic acid
InChIKeySCOPIBMUIURTPA-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)CC(=O)C(=O)O)C

Computed by PubChem (NCBI)