CAS 1250536-34-5 is the registry number for 3-(2,3-Dimethylphenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,3-dimethylphenyl)-2-oxopropanoic acid (CAS 1250536-34-5) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 3-(2,3-dimethylphenyl)-2-oxopropanoic acid. InChIKey: SCOPIBMUIURTPA-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 3-(2,3-dimethylphenyl)-2-oxopropanoic acid |
| InChIKey | SCOPIBMUIURTPA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CC(=O)C(=O)O)C |
Computed by PubChem (NCBI)