Products 125067-76-7
CAS 125067-76-7 appears in our catalog under these names: 6-Amino-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid hydrochloride, 6-Amino-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 50mg, 0,5g, 1g, 250mg, 100mg.
6-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid;hydrochloride (CAS 125067-76-7) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 6-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid;hydrochloride. InChIKey: QFCZKXTVCFUSTO-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 6-amino-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid;hydrochloride |
| InChIKey | QFCZKXTVCFUSTO-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=C(C=C2)N)C(=O)O.Cl |
Computed by PubChem (NCBI)