CAS 1250986-82-3 appears in our catalog under these names: 3-(Pyrazin-2-yloxy)benzoic acid, 3-(Pyrazin-2-yloxy)benzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
3-pyrazin-2-yloxybenzoic acid (CAS 1250986-82-3) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 3-pyrazin-2-yloxybenzoic acid. InChIKey: WGJMHXFXZDFTOP-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 3-pyrazin-2-yloxybenzoic acid |
| InChIKey | WGJMHXFXZDFTOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=NC=CN=C2)C(=O)O |
Computed by PubChem (NCBI)