Products 1250996-97-4
CAS 1250996-97-4 is the registry number for Ethyl 6-chloroimidazo[1,2-a]pyrazine-3-carboxylate, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
Ethyl 6-chloroimidazo[1,2-a]pyrazine-3-carboxylate (CAS 1250996-97-4) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 6-chloroimidazo[1,2-a]pyrazine-3-carboxylate. InChIKey: CNONMADHJQAEAI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 6-chloroimidazo[1,2-a]pyrazine-3-carboxylate |
| InChIKey | CNONMADHJQAEAI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2N1C=C(N=C2)Cl |
Computed by PubChem (NCBI)