CAS 1251012-01-7 is the registry number for tert–Butyl 2–(hydroxymethyl)–4H–pyrrolo(3,4–d)oxazole–5(6H)–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg.
Tert-butyl 2-(hydroxymethyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazole-5-carboxylate (CAS 1251012-01-7) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: tert-butyl 2-(hydroxymethyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazole-5-carboxylate. InChIKey: AOJWKTXUJDICQJ-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | tert-butyl 2-(hydroxymethyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazole-5-carboxylate |
| InChIKey | AOJWKTXUJDICQJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)OC(=N2)CO |
Computed by PubChem (NCBI)