CAS 1251769-10-4 is the registry number for (S)-Boc-2(4-methyltetrahydro-2H-pyran-4-yl)-Gly-OH, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(4-methyloxan-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1251769-10-4) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: (2S)-2-(4-methyloxan-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: YDPPDXGANHHAFH-SECBINFHSA-N.
| Molecular formula | C13H23NO5 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | (2S)-2-(4-methyloxan-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | YDPPDXGANHHAFH-SECBINFHSA-N |
| SMILES | CC1(CCOCC1)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)