Products 1251923-29-1
CAS 1251923-29-1 is the registry number for Methyl 2-(adamantan-1-yl)-2-methanesulfonamidoacetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-(1-adamantyl)-2-(methanesulfonamido)acetate (CAS 1251923-29-1) is a chemical compound with the molecular formula C14H23NO4S and a molecular weight of 301.40 g/mol. IUPAC name: methyl 2-(1-adamantyl)-2-(methanesulfonamido)acetate. InChIKey: NDNFABIUONPIRT-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4S |
|---|---|
| Molecular weight | 301.40 g/mol |
| IUPAC name | methyl 2-(1-adamantyl)-2-(methanesulfonamido)acetate |
| InChIKey | NDNFABIUONPIRT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C12CC3CC(C1)CC(C3)C2)NS(=O)(=O)C |
Computed by PubChem (NCBI)