Products 1300037-87-9

CAS 1300037-87-9 is the registry number for Tapentadol O-Sulfate. Offered by: TRC. Available pack sizes: 10mg.

Structural formula: {0} (CAS {1})

[3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] hydrogen sulfate (CAS 1300037-87-9) is a chemical compound with the molecular formula C14H23NO4S and a molecular weight of 301.40 g/mol. IUPAC name: [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] hydrogen sulfate. InChIKey: HPEFZESOUVTBSA-SMDDNHRTSA-N.

Identity
Molecular formulaC14H23NO4S
Molecular weight301.40 g/mol
IUPAC name[3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] hydrogen sulfate
InChIKeyHPEFZESOUVTBSA-SMDDNHRTSA-N
SMILESCC[C@@H](C1=CC(=CC=C1)OS(=O)(=O)O)[C@@H](C)CN(C)C

Computed by PubChem (NCBI)