CAS 1300037-87-9 is the registry number for Tapentadol O-Sulfate. Offered by: TRC. Available pack sizes: 10mg.
[3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] hydrogen sulfate (CAS 1300037-87-9) is a chemical compound with the molecular formula C14H23NO4S and a molecular weight of 301.40 g/mol. IUPAC name: [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] hydrogen sulfate. InChIKey: HPEFZESOUVTBSA-SMDDNHRTSA-N.
| Molecular formula | C14H23NO4S |
|---|---|
| Molecular weight | 301.40 g/mol |
| IUPAC name | [3-[(2R,3R)-1-(dimethylamino)-2-methylpentan-3-yl]phenyl] hydrogen sulfate |
| InChIKey | HPEFZESOUVTBSA-SMDDNHRTSA-N |
| SMILES | CC[C@@H](C1=CC(=CC=C1)OS(=O)(=O)O)[C@@H](C)CN(C)C |
Computed by PubChem (NCBI)