Products 2891581-82-9
CAS 2891581-82-9 is the registry number for (2R)-2-amino-3-(1-methylcyclopropyl)propan-1-ol,4-methylbenzenesulfonic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2R)-2-amino-3-(1-methylcyclopropyl)propan-1-ol;4-methylbenzenesulfonic acid (CAS 2891581-82-9) is a chemical compound with the molecular formula C14H23NO4S and a molecular weight of 301.40 g/mol. IUPAC name: (2R)-2-amino-3-(1-methylcyclopropyl)propan-1-ol;4-methylbenzenesulfonic acid. InChIKey: IBEMOVKVDQIBFN-FYZOBXCZSA-N.
| Molecular formula | C14H23NO4S |
|---|---|
| Molecular weight | 301.40 g/mol |
| IUPAC name | (2R)-2-amino-3-(1-methylcyclopropyl)propan-1-ol;4-methylbenzenesulfonic acid |
| InChIKey | IBEMOVKVDQIBFN-FYZOBXCZSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1(CC1)C[C@H](CO)N |
Computed by PubChem (NCBI)