Products 1346598-84-2
CAS 1346598-84-2 is the registry number for Tapentadol-d5 O-Sulfate. Offered by: TRC. Available pack sizes: 25mg.
[3-[(3R,4R)-1,1,1,2,2-pentadeuterio-5-(dimethylamino)-4-methylpentan-3-yl]phenyl] hydrogen sulfate (CAS 1346598-84-2) is a chemical compound with the molecular formula C14H23NO4S and a molecular weight of 306.43 g/mol. IUPAC name: [3-[(3R,4R)-1,1,1,2,2-pentadeuterio-5-(dimethylamino)-4-methylpentan-3-yl]phenyl] hydrogen sulfate. InChIKey: HPEFZESOUVTBSA-ODWVCUCBSA-N.
| Molecular formula | C14H23NO4S |
|---|---|
| Molecular weight | 306.43 g/mol |
| IUPAC name | [3-[(3R,4R)-1,1,1,2,2-pentadeuterio-5-(dimethylamino)-4-methylpentan-3-yl]phenyl] hydrogen sulfate |
| InChIKey | HPEFZESOUVTBSA-ODWVCUCBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[C@@H](C1=CC(=CC=C1)OS(=O)(=O)O)[C@@H](C)CN(C)C |
Computed by PubChem (NCBI)
Synonyms:
Tapentadol-d5 O-Sulfate, Tapentadol O-sulfate-d5