Products 1453316-13-6

CAS 1453316-13-6 is the registry number for 2-tert-Butyl 8-ethyl 6-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 8-O-ethyl 6-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate (CAS 1453316-13-6) is a chemical compound with the molecular formula C14H23NO4S and a molecular weight of 301.40 g/mol. IUPAC name: 2-O-tert-butyl 8-O-ethyl 6-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate. InChIKey: WURUNYUYWWOXJZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H23NO4S
Molecular weight301.40 g/mol
IUPAC name2-O-tert-butyl 8-O-ethyl 6-thia-2-azaspiro[3.4]octane-2,8-dicarboxylate
InChIKeyWURUNYUYWWOXJZ-UHFFFAOYSA-N
SMILESCCOC(=O)C1CSCC12CN(C2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)