CAS 1251924-28-3 appears in our catalog under these names: 2-Acetamido-2-(3-(trifluoromethyl)phenyl)propanoic acid, 2-Acetamido-2-[3-(trifluoromethyl)phenyl]propanoic acid, 95%, 2-Acetamido-2-(3-(trifluoromethyl)phenyl)propanoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 250mg, 2,5g, 1g, 5g.
2-acetamido-2-[3-(trifluoromethyl)phenyl]propanoic acid (CAS 1251924-28-3) is a chemical compound with the molecular formula C12H12F3NO3 and a molecular weight of 275.22 g/mol. IUPAC name: 2-acetamido-2-[3-(trifluoromethyl)phenyl]propanoic acid. InChIKey: QYAZKNJZYGILFU-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO3 |
|---|---|
| Molecular weight | 275.22 g/mol |
| IUPAC name | 2-acetamido-2-[3-(trifluoromethyl)phenyl]propanoic acid |
| InChIKey | QYAZKNJZYGILFU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(C)(C1=CC(=CC=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)