CAS 23635-30-5 is the registry number for Tfa-Phe-OMe. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
Methyl (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate (CAS 23635-30-5) is a chemical compound with the molecular formula C12H12F3NO3 and a molecular weight of 275.22 g/mol. IUPAC name: methyl (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate. InChIKey: ZYMGRJXIRUWDLX-VIFPVBQESA-N.
| Molecular formula | C12H12F3NO3 |
|---|---|
| Molecular weight | 275.22 g/mol |
| IUPAC name | methyl (2S)-3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| InChIKey | ZYMGRJXIRUWDLX-VIFPVBQESA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)