CAS 68281-49-2 appears in our catalog under these names: Ethyl 6-(trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylate, 95%, Ethyl 6-(trifluoromethyl)-3,4-dihydro-2H-benzo(b)(1,4)oxazine-2-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate (CAS 68281-49-2) is a chemical compound with the molecular formula C12H12F3NO3 and a molecular weight of 275.22 g/mol. IUPAC name: ethyl 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate. InChIKey: BNGNTYNJFMUATE-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO3 |
|---|---|
| Molecular weight | 275.22 g/mol |
| IUPAC name | ethyl 6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate |
| InChIKey | BNGNTYNJFMUATE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNC2=C(O1)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)