CAS 1803605-37-9 appears in our catalog under these names: 1-(2-Aminophenyl)-2-methylprop-2-en-1-one, trifluoroacetic acid, 95%, 1-(2-Aminophenyl)-2-methylprop-2-en-1-one, trifluoroacetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2-aminophenyl)-2-methylprop-2-en-1-one;2,2,2-trifluoroacetic acid (CAS 1803605-37-9) is a chemical compound with the molecular formula C12H12F3NO3 and a molecular weight of 275.22 g/mol. IUPAC name: 1-(2-aminophenyl)-2-methylprop-2-en-1-one;2,2,2-trifluoroacetic acid. InChIKey: FIJMVSLKVQMPEK-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO3 |
|---|---|
| Molecular weight | 275.22 g/mol |
| IUPAC name | 1-(2-aminophenyl)-2-methylprop-2-en-1-one;2,2,2-trifluoroacetic acid |
| InChIKey | FIJMVSLKVQMPEK-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)C1=CC=CC=C1N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)