CAS 677704-58-4 appears in our catalog under these names: 4-Morpholin-4-yl-3-(trifluoromethyl)benzoic acid, 95%, 4-Morpholino-3-(trifluoromethyl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
4-morpholin-4-yl-3-(trifluoromethyl)benzoic acid (CAS 677704-58-4) is a chemical compound with the molecular formula C12H12F3NO3 and a molecular weight of 275.22 g/mol. IUPAC name: 4-morpholin-4-yl-3-(trifluoromethyl)benzoic acid. InChIKey: NVFKWVJORSZTSG-UHFFFAOYSA-N.
| Molecular formula | C12H12F3NO3 |
|---|---|
| Molecular weight | 275.22 g/mol |
| IUPAC name | 4-morpholin-4-yl-3-(trifluoromethyl)benzoic acid |
| InChIKey | NVFKWVJORSZTSG-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)