CAS 1251925-36-6 is the registry number for Benzo[d]oxazole-5-carbothioamide 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
1,3-benzoxazole-5-carbothioamide (CAS 1251925-36-6) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 1,3-benzoxazole-5-carbothioamide. InChIKey: UZFPBCDAQZEMIY-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 1,3-benzoxazole-5-carbothioamide |
| InChIKey | UZFPBCDAQZEMIY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=S)N)N=CO2 |
Computed by PubChem (NCBI)