CAS 1770141-59-7 appears in our catalog under these names: 1-(Difluoromethyl)-5-nitro-1H-indole, 95%, 1-(Difluoromethyl)-5-nitro-1H-indole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(difluoromethyl)-5-nitroindole (CAS 1770141-59-7) is a chemical compound with the molecular formula C9H6F2N2O2 and a molecular weight of 212.15 g/mol. IUPAC name: 1-(difluoromethyl)-5-nitroindole. InChIKey: IQZYIGSIIILMET-UHFFFAOYSA-N.
| Molecular formula | C9H6F2N2O2 |
|---|---|
| Molecular weight | 212.15 g/mol |
| IUPAC name | 1-(difluoromethyl)-5-nitroindole |
| InChIKey | IQZYIGSIIILMET-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2C(F)F)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)