CAS 1252601-88-9 is the registry number for (Methoxycarbonyl)–L–alloisoleucine. Offered by: GLPBio. Available pack sizes: 1g.
(2S,3R)-2-(methoxycarbonylamino)-3-methylpentanoic acid (CAS 1252601-88-9) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2S,3R)-2-(methoxycarbonylamino)-3-methylpentanoic acid. InChIKey: LVKROKMNCYTCHK-RITPCOANSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2S,3R)-2-(methoxycarbonylamino)-3-methylpentanoic acid |
| InChIKey | LVKROKMNCYTCHK-RITPCOANSA-N |
| SMILES | CC[C@@H](C)[C@@H](C(=O)O)NC(=O)OC |
Computed by PubChem (NCBI)