CAS 74761-39-0 appears in our catalog under these names: (Methoxycarbonyl)–L–isoleucine, (2S,3S)-2-((Methoxycarbonyl)amino)-3-methylpentanoic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(2S,3S)-2-(methoxycarbonylamino)-3-methylpentanoic acid (CAS 74761-39-0) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2S,3S)-2-(methoxycarbonylamino)-3-methylpentanoic acid. InChIKey: LVKROKMNCYTCHK-WDSKDSINSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2S,3S)-2-(methoxycarbonylamino)-3-methylpentanoic acid |
| InChIKey | LVKROKMNCYTCHK-WDSKDSINSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)OC |
Computed by PubChem (NCBI)