Products 74761-39-0

CAS 74761-39-0 appears in our catalog under these names: (Methoxycarbonyl)–L–isoleucine, (2S,3S)-2-((Methoxycarbonyl)amino)-3-methylpentanoic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

(2S,3S)-2-(methoxycarbonylamino)-3-methylpentanoic acid (CAS 74761-39-0) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2S,3S)-2-(methoxycarbonylamino)-3-methylpentanoic acid. InChIKey: LVKROKMNCYTCHK-WDSKDSINSA-N.

Identity
Molecular formulaC8H15NO4
Molecular weight189.21 g/mol
IUPAC name(2S,3S)-2-(methoxycarbonylamino)-3-methylpentanoic acid
InChIKeyLVKROKMNCYTCHK-WDSKDSINSA-N
SMILESCC[C@H](C)[C@@H](C(=O)O)NC(=O)OC

Computed by PubChem (NCBI)