CAS 1253215-65-4 is the registry number for 4,4,5,5-Tetramethyl-2-(oxan-2-yl)-1,3,2-dioxaborolane. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4,4,5,5-tetramethyl-2-(oxan-2-yl)-1,3,2-dioxaborolane (CAS 1253215-65-4) is a chemical compound with the molecular formula C11H21BO3 and a molecular weight of 212.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(oxan-2-yl)-1,3,2-dioxaborolane. InChIKey: ONOWUKBXDGONMF-UHFFFAOYSA-N.
| Molecular formula | C11H21BO3 |
|---|---|
| Molecular weight | 212.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(oxan-2-yl)-1,3,2-dioxaborolane |
| InChIKey | ONOWUKBXDGONMF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCCO2 |
Computed by PubChem (NCBI)