CAS 1617543-88-0 appears in our catalog under these names: (tetrahydro-furan-3-yl)methylboronic acid pinacol ester, 96%, (Tetrahydro-furan-3-yl)methylboronic acid pinacol ester. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 100mg, 250mg, 500mg, 1000mg.
4,4,5,5-tetramethyl-2-(oxolan-3-ylmethyl)-1,3,2-dioxaborolane (CAS 1617543-88-0) is a chemical compound with the molecular formula C11H21BO3 and a molecular weight of 212.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(oxolan-3-ylmethyl)-1,3,2-dioxaborolane. InChIKey: BNYSUGPIVCHLSI-UHFFFAOYSA-N.
| Molecular formula | C11H21BO3 |
|---|---|
| Molecular weight | 212.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(oxolan-3-ylmethyl)-1,3,2-dioxaborolane |
| InChIKey | BNYSUGPIVCHLSI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CCOC2 |
Computed by PubChem (NCBI)