Products 1398771-34-0
CAS 1398771-34-0 is the registry number for (E)-2-(3-Methoxy-2-methylprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
2-[(E)-3-methoxy-2-methylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1398771-34-0) is a chemical compound with the molecular formula C11H21BO3 and a molecular weight of 212.10 g/mol. IUPAC name: 2-[(E)-3-methoxy-2-methylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NMMLJPPPMPZHRH-VQHVLOKHSA-N.
| Molecular formula | C11H21BO3 |
|---|---|
| Molecular weight | 212.10 g/mol |
| IUPAC name | 2-[(E)-3-methoxy-2-methylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NMMLJPPPMPZHRH-VQHVLOKHSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C(\C)/COC |
Computed by PubChem (NCBI)