CAS 1253654-79-3 is the registry number for 4,6-Dichloro-3-methylisoxazolo(5,4-d)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,6-dichloro-3-methyl-[1,2]oxazolo[5,4-d]pyrimidine (CAS 1253654-79-3) is a chemical compound with the molecular formula C6H3Cl2N3O and a molecular weight of 204.01 g/mol. IUPAC name: 4,6-dichloro-3-methyl-[1,2]oxazolo[5,4-d]pyrimidine. InChIKey: NPESVPRQWIQXCG-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3O |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 4,6-dichloro-3-methyl-[1,2]oxazolo[5,4-d]pyrimidine |
| InChIKey | NPESVPRQWIQXCG-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)