Products 56032-14-5
CAS 56032-14-5 is the registry number for 2,4-Dichloro-6-methoxypyrimidine-5-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6-methoxypyrimidine-5-carbonitrile (CAS 56032-14-5) is a chemical compound with the molecular formula C6H3Cl2N3O and a molecular weight of 204.01 g/mol. IUPAC name: 2,4-dichloro-6-methoxypyrimidine-5-carbonitrile. InChIKey: ZBIMQZXQTPQRNV-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3O |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 2,4-dichloro-6-methoxypyrimidine-5-carbonitrile |
| InChIKey | ZBIMQZXQTPQRNV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC(=N1)Cl)Cl)C#N |
Computed by PubChem (NCBI)