CAS 56032-15-6 is the registry number for 4,6-Dichloro-2-methoxypyrimidine-5-carbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-2-methoxypyrimidine-5-carbonitrile (CAS 56032-15-6) is a chemical compound with the molecular formula C6H3Cl2N3O and a molecular weight of 204.01 g/mol. IUPAC name: 4,6-dichloro-2-methoxypyrimidine-5-carbonitrile. InChIKey: BRJFPNSNFVBIBD-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3O |
|---|---|
| Molecular weight | 204.01 g/mol |
| IUPAC name | 4,6-dichloro-2-methoxypyrimidine-5-carbonitrile |
| InChIKey | BRJFPNSNFVBIBD-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C(=N1)Cl)C#N)Cl |
Computed by PubChem (NCBI)